Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Taurine, 99%
CAS: 107-35-7 Molecular Formula: C2H7NO3S Molecular Weight (g/mol): 125.14 MDL Number: MFCD00008197 InChI Key: XOAAWQZATWQOTB-UHFFFAOYSA-N Synonym: taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid PubChem CID: 1123 ChEBI: CHEBI:15891 IUPAC Name: 2-aminoethanesulfonic acid SMILES: NCCS(O)(=O)=O
| PubChem CID | 1123 |
|---|---|
| CAS | 107-35-7 |
| Molecular Weight (g/mol) | 125.14 |
| ChEBI | CHEBI:15891 |
| MDL Number | MFCD00008197 |
| SMILES | NCCS(O)(=O)=O |
| Synonym | taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid |
| IUPAC Name | 2-aminoethanesulfonic acid |
| InChI Key | XOAAWQZATWQOTB-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO3S |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, tetrasodium salt dihydrate, 99%
CAS: 10378-23-1 Molecular Formula: C10H12N2Na4O8·2H2O Molecular Weight (g/mol): 416.21 InChI Key: DGWOWDJDIBPYOR-UHFFFAOYSA-N Synonym: ethylenediaminetetraacetic acid tetrasodium salt dihydrate,tetrasodium ethylenediaminetetraacetate dihydrate,edta-na4,edta tetrasodium salt,edta tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate,64-02-8 anhydrous,ksc909a7h,edta tetrasodium salt dihydrate,tetrapotassium ion 4-edta dihydrate PubChem CID: 131843362 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;dihydrate SMILES: C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.O.[Na].[Na].[Na].[Na]
| PubChem CID | 131843362 |
|---|---|
| CAS | 10378-23-1 |
| Molecular Weight (g/mol) | 416.21 |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.O.[Na].[Na].[Na].[Na] |
| Synonym | ethylenediaminetetraacetic acid tetrasodium salt dihydrate,tetrasodium ethylenediaminetetraacetate dihydrate,edta-na4,edta tetrasodium salt,edta tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate,64-02-8 anhydrous,ksc909a7h,edta tetrasodium salt dihydrate,tetrapotassium ion 4-edta dihydrate |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;dihydrate |
| InChI Key | DGWOWDJDIBPYOR-UHFFFAOYSA-N |
| Molecular Formula | C10H12N2Na4O8·2H2O |
Ammonium acetate, 97%
CAS: 631-61-8 Molecular Formula: C2H7NO2 Molecular Weight (g/mol): 77.083 MDL Number: MFCD00013066 InChI Key: USFZMSVCRYTOJT-UHFFFAOYSA-N Synonym: ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 PubChem CID: 517165 ChEBI: CHEBI:62947 IUPAC Name: azanium;acetate SMILES: CC(=O)[O-].[NH4+]
| PubChem CID | 517165 |
|---|---|
| CAS | 631-61-8 |
| Molecular Weight (g/mol) | 77.083 |
| ChEBI | CHEBI:62947 |
| MDL Number | MFCD00013066 |
| SMILES | CC(=O)[O-].[NH4+] |
| Synonym | ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 |
| IUPAC Name | azanium;acetate |
| InChI Key | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO2 |
Sodium vinylsulfonate, tech. ca 25% aq. soln.
CAS: 3039-83-6 Molecular Formula: C2H3NaO3S Molecular Weight (g/mol): 130.09 MDL Number: MFCD00007520 InChI Key: BWYYYTVSBPRQCN-UHFFFAOYSA-M Synonym: sodium ethenesulfonate,sodium vinylsulfonate,ethenesulfonic acid, sodium salt,sodium ethylenesulfonate,sodium vinyl sulfonate,sodium ethylenesulphonate,sodium apolate,unii-f7k3l38z7b,sodium ethenesulfonate in h2o,lyapolate sodium usan PubChem CID: 3270262 IUPAC Name: sodium;ethenesulfonate SMILES: [Na+].[O-]S(=O)(=O)C=C
| PubChem CID | 3270262 |
|---|---|
| CAS | 3039-83-6 |
| Molecular Weight (g/mol) | 130.09 |
| MDL Number | MFCD00007520 |
| SMILES | [Na+].[O-]S(=O)(=O)C=C |
| Synonym | sodium ethenesulfonate,sodium vinylsulfonate,ethenesulfonic acid, sodium salt,sodium ethylenesulfonate,sodium vinyl sulfonate,sodium ethylenesulphonate,sodium apolate,unii-f7k3l38z7b,sodium ethenesulfonate in h2o,lyapolate sodium usan |
| IUPAC Name | sodium;ethenesulfonate |
| InChI Key | BWYYYTVSBPRQCN-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO3S |
Phorbol 12-myristate 13-acetate, 95%
CAS: 16561-29-8 Molecular Formula: C36H56O8 Molecular Weight (g/mol): 616.84 MDL Number: MFCD00036736 InChI Key: PHEDXBVPIONUQT-RGYGYFBISA-N Synonym: phorbol 12-myristate 13-acetate,phorbol ester,12-o-tetradecanoylphorbol-13-acetate,12-o-tetradecanoylphorbol 13-acetate,factor a1,tetradecanoylphorbol acetate,12-tetradecanoylphorbol 13-acetate,factor a1 croton oil,phorbol 13-acetate 12-myristate,phorbol-12-myristate-13-acetate PubChem CID: 27924 ChEBI: CHEBI:37537 IUPAC Name: (1S,2S,6R,10S,11R,13S,14R,15R)-13-(acetyloxy)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxotetracyclo[8.5.0.0²,⁶.0¹¹,¹³]pentadeca-3,8-dien-14-yl tetradecanoate SMILES: CCCCCCCCCCCCCC(=O)O[C@@H]1[C@@H](C)[C@]2(O)[C@@H]3C=C(C)C(=O)[C@@]3(O)CC(CO)=C[C@H]2[C@@H]2C(C)(C)[C@]12OC(C)=O
| PubChem CID | 27924 |
|---|---|
| CAS | 16561-29-8 |
| Molecular Weight (g/mol) | 616.84 |
| ChEBI | CHEBI:37537 |
| MDL Number | MFCD00036736 |
| SMILES | CCCCCCCCCCCCCC(=O)O[C@@H]1[C@@H](C)[C@]2(O)[C@@H]3C=C(C)C(=O)[C@@]3(O)CC(CO)=C[C@H]2[C@@H]2C(C)(C)[C@]12OC(C)=O |
| Synonym | phorbol 12-myristate 13-acetate,phorbol ester,12-o-tetradecanoylphorbol-13-acetate,12-o-tetradecanoylphorbol 13-acetate,factor a1,tetradecanoylphorbol acetate,12-tetradecanoylphorbol 13-acetate,factor a1 croton oil,phorbol 13-acetate 12-myristate,phorbol-12-myristate-13-acetate |
| IUPAC Name | (1S,2S,6R,10S,11R,13S,14R,15R)-13-(acetyloxy)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxotetracyclo[8.5.0.0²,⁶.0¹¹,¹³]pentadeca-3,8-dien-14-yl tetradecanoate |
| InChI Key | PHEDXBVPIONUQT-RGYGYFBISA-N |
| Molecular Formula | C36H56O8 |
2,2,2-Trichloroethanol, 99%
CAS: 115-20-8 Molecular Formula: C2H3Cl3O Molecular Weight (g/mol): 149.4 MDL Number: MFCD00004677 InChI Key: KPWDGTGXUYRARH-UHFFFAOYSA-N Synonym: trichloroethanol,trichlorethanol,trichloroethyl alcohol,ethanol, 2,2,2-trichloro,2,2,2-trichloro-1-ethanol,hydroxymethyl trichloromethane,2,2,2-trichloroethyl alcohol,2,2,2-trichloroethan-1-ol,unii-aw835aj62n,beta-trichloroethanol PubChem CID: 8259 ChEBI: CHEBI:28094 IUPAC Name: 2,2,2-trichloroethanol SMILES: C(C(Cl)(Cl)Cl)O
| PubChem CID | 8259 |
|---|---|
| CAS | 115-20-8 |
| Molecular Weight (g/mol) | 149.4 |
| ChEBI | CHEBI:28094 |
| MDL Number | MFCD00004677 |
| SMILES | C(C(Cl)(Cl)Cl)O |
| Synonym | trichloroethanol,trichlorethanol,trichloroethyl alcohol,ethanol, 2,2,2-trichloro,2,2,2-trichloro-1-ethanol,hydroxymethyl trichloromethane,2,2,2-trichloroethyl alcohol,2,2,2-trichloroethan-1-ol,unii-aw835aj62n,beta-trichloroethanol |
| IUPAC Name | 2,2,2-trichloroethanol |
| InChI Key | KPWDGTGXUYRARH-UHFFFAOYSA-N |
| Molecular Formula | C2H3Cl3O |
Thermo Scientific Chemicals Quinine sulfate dihydrate, 99+%
CAS: 6119-70-6 Molecular Formula: C40H54N4O10S Molecular Weight (g/mol): 782.95 MDL Number: MFCD00150790 InChI Key: ZHNFLHYOFXQIOW-OIGVVMIYNA-N PubChem CID: 134129495 IUPAC Name: (R)-[(2R,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;sulfuric acid;tetrahydrate SMILES: O.O.OS(O)(=O)=O.[H][C@@]1(CN2CCC1C[C@@]2([H])[C@H](O)C1=C2C=C(OC)C=CC2=NC=C1)C=C.[H][C@@]1(CN2CCC1C[C@@]2([H])[C@H](O)C1=C2C=C(OC)C=CC2=NC=C1)C=C
| PubChem CID | 134129495 |
|---|---|
| CAS | 6119-70-6 |
| Molecular Weight (g/mol) | 782.95 |
| MDL Number | MFCD00150790 |
| SMILES | O.O.OS(O)(=O)=O.[H][C@@]1(CN2CCC1C[C@@]2([H])[C@H](O)C1=C2C=C(OC)C=CC2=NC=C1)C=C.[H][C@@]1(CN2CCC1C[C@@]2([H])[C@H](O)C1=C2C=C(OC)C=CC2=NC=C1)C=C |
| IUPAC Name | (R)-[(2R,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;sulfuric acid;tetrahydrate |
| InChI Key | ZHNFLHYOFXQIOW-OIGVVMIYNA-N |
| Molecular Formula | C40H54N4O10S |
Methyl benzoate, 99%
CAS: 93-58-3 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 InChI Key: QPJVMBTYPHYUOC-UHFFFAOYSA-N Synonym: methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le PubChem CID: 7150 ChEBI: CHEBI:72775 IUPAC Name: methyl benzoate SMILES: COC(=O)C1=CC=CC=C1
| PubChem CID | 7150 |
|---|---|
| CAS | 93-58-3 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:72775 |
| SMILES | COC(=O)C1=CC=CC=C1 |
| Synonym | methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le |
| IUPAC Name | methyl benzoate |
| InChI Key | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
L-Ascorbic acid sodium salt, 99%
CAS: 134-03-2 Molecular Formula: C6H7NaO6 Molecular Weight (g/mol): 198.11 MDL Number: MFCD00082340 InChI Key: IFVCRSPJFHGFCG-HXPAKLQESA-N Synonym: sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate PubChem CID: 131674100 IUPAC Name: sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
| PubChem CID | 131674100 |
|---|---|
| CAS | 134-03-2 |
| Molecular Weight (g/mol) | 198.11 |
| MDL Number | MFCD00082340 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| Synonym | sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate |
| IUPAC Name | sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
| InChI Key | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Molecular Formula | C6H7NaO6 |
Thermo Scientific Chemicals Uracil, 99+%
CAS: 66-22-8 Molecular Formula: C4H4N2O2 Molecular Weight (g/mol): 112.09 MDL Number: MFCD00006016 InChI Key: ISAKRJDGNUQOIC-UHFFFAOYSA-N Synonym: uracil,2,4-dihydroxypyrimidine,2,4 1h,3h-pyrimidinedione,2,4-pyrimidinediol,2,4-dioxopyrimidine,pyrimidine-2,4 1h,3h-dione,pirod,2,4-pyrimidinedione,pyrod,hybar x PubChem CID: 1174 ChEBI: CHEBI:17568 IUPAC Name: 1H-pyrimidine-2,4-dione SMILES: O=C1NC=CC(=O)N1
| PubChem CID | 1174 |
|---|---|
| CAS | 66-22-8 |
| Molecular Weight (g/mol) | 112.09 |
| ChEBI | CHEBI:17568 |
| MDL Number | MFCD00006016 |
| SMILES | O=C1NC=CC(=O)N1 |
| Synonym | uracil,2,4-dihydroxypyrimidine,2,4 1h,3h-pyrimidinedione,2,4-pyrimidinediol,2,4-dioxopyrimidine,pyrimidine-2,4 1h,3h-dione,pirod,2,4-pyrimidinedione,pyrod,hybar x |
| IUPAC Name | 1H-pyrimidine-2,4-dione |
| InChI Key | ISAKRJDGNUQOIC-UHFFFAOYSA-N |
| Molecular Formula | C4H4N2O2 |
Quercetin dihydrate, 97%
CAS: 6151-25-3 Molecular Formula: C15H14O9 Molecular Weight (g/mol): 338.27 MDL Number: MFCD00149487 InChI Key: GMGIWEZSKCNYSW-UHFFFAOYSA-N Synonym: quercetin dihydrate,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one dihydrate,quercetine dihydrate,quercetin, dihydrate,ccris 3304,3,3',4',5,7-pentahydroxyflavone dihydrate,quercetin dihydrate sophoretin,flavone, 3,3',4',5,7-pentahydroxy-, dihydrate,dsstox_cid_1219,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-1-benzopyran-4-one dihydrate PubChem CID: 5284452 IUPAC Name: 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;dihydrate SMILES: O.O.OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC=C(O)C(O)=C2)=C1
| PubChem CID | 5284452 |
|---|---|
| CAS | 6151-25-3 |
| Molecular Weight (g/mol) | 338.27 |
| MDL Number | MFCD00149487 |
| SMILES | O.O.OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC=C(O)C(O)=C2)=C1 |
| Synonym | quercetin dihydrate,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one dihydrate,quercetine dihydrate,quercetin, dihydrate,ccris 3304,3,3',4',5,7-pentahydroxyflavone dihydrate,quercetin dihydrate sophoretin,flavone, 3,3',4',5,7-pentahydroxy-, dihydrate,dsstox_cid_1219,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-1-benzopyran-4-one dihydrate |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;dihydrate |
| InChI Key | GMGIWEZSKCNYSW-UHFFFAOYSA-N |
| Molecular Formula | C15H14O9 |
Polyethylene Glycol 300, TCI America™
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 300 IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 300 |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Decane, 99+%, pure
CAS: 124-18-5 Molecular Formula: C10H22 Molecular Weight (g/mol): 142.286 MDL Number: MFCD00008954 InChI Key: DIOQZVSQGTUSAI-UHFFFAOYSA-N Synonym: n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 PubChem CID: 15600 ChEBI: CHEBI:41808 IUPAC Name: decane SMILES: CCCCCCCCCC
| PubChem CID | 15600 |
|---|---|
| CAS | 124-18-5 |
| Molecular Weight (g/mol) | 142.286 |
| ChEBI | CHEBI:41808 |
| MDL Number | MFCD00008954 |
| SMILES | CCCCCCCCCC |
| Synonym | n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 |
| IUPAC Name | decane |
| InChI Key | DIOQZVSQGTUSAI-UHFFFAOYSA-N |
| Molecular Formula | C10H22 |
1,2,4-Trimethylbenzene, 98%
CAS: 95-63-6 MDL Number: MFCD00008527 InChI Key: GWHJZXXIDMPWGX-UHFFFAOYSA-N Synonym: pseudocumene,pseudocumol,psi-cumene,as-trimethylbenzene,1,3,4-trimethylbenzene,benzene, 1,2,4-trimethyl,uns-trimethylbenzene,1,2,5-trimethylbenzene,asymmetrical trimethylbenzene,.psi.-cumene PubChem CID: 7247 ChEBI: CHEBI:34039 IUPAC Name: 1,2,4-trimethylbenzene SMILES: CC1=CC(=C(C=C1)C)C
| PubChem CID | 7247 |
|---|---|
| CAS | 95-63-6 |
| ChEBI | CHEBI:34039 |
| MDL Number | MFCD00008527 |
| SMILES | CC1=CC(=C(C=C1)C)C |
| Synonym | pseudocumene,pseudocumol,psi-cumene,as-trimethylbenzene,1,3,4-trimethylbenzene,benzene, 1,2,4-trimethyl,uns-trimethylbenzene,1,2,5-trimethylbenzene,asymmetrical trimethylbenzene,.psi.-cumene |
| IUPAC Name | 1,2,4-trimethylbenzene |
| InChI Key | GWHJZXXIDMPWGX-UHFFFAOYSA-N |
Pyridoxine hydrochloride, 99%
CAS: 58-56-0 Molecular Formula: C8H12ClNO3 Molecular Weight (g/mol): 205.638 MDL Number: MFCD00012807 InChI Key: ZUFQODAHGAHPFQ-UHFFFAOYSA-N Synonym: pyridoxine hydrochloride,pyridoxine hcl,pyridoxol hydrochloride,vitamin b6,alestrol,becilan,benadon,hexavibex,hexermin,hexobion PubChem CID: 6019 ChEBI: CHEBI:30961 IUPAC Name: 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride SMILES: CC1=NC=C(C(=C1O)CO)CO.Cl
| PubChem CID | 6019 |
|---|---|
| CAS | 58-56-0 |
| Molecular Weight (g/mol) | 205.638 |
| ChEBI | CHEBI:30961 |
| MDL Number | MFCD00012807 |
| SMILES | CC1=NC=C(C(=C1O)CO)CO.Cl |
| Synonym | pyridoxine hydrochloride,pyridoxine hcl,pyridoxol hydrochloride,vitamin b6,alestrol,becilan,benadon,hexavibex,hexermin,hexobion |
| IUPAC Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride |
| InChI Key | ZUFQODAHGAHPFQ-UHFFFAOYSA-N |
| Molecular Formula | C8H12ClNO3 |